C22H18N4O4S3 — CID 16550213
N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 16550213) has the molecular formula C22H18N4O4S3 and a molecular weight of 498.61 g/mol. Its IUPAC name is N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 16550213 |
| Molecular Formula | C22H18N4O4S3 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | O=C(Nc1nc(-c2cccs2)c(-c2cccs2)s1)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C22H18N4O4S3/c27-21(15-13-14(26(28)29)5-6-16(15)25-7-9-30-10-8-25)24-22-23-19(17-3-1-11-31-17)20(33-22)18-4-2-12-32-18/h1-6,11-13H,7-10H2,(H,23,24,27) |
| InChIKey | CVOLCNZFBGYZRF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|