C21H19ClN4O4S — CID 16959511
N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 16959511) has the molecular formula C21H19ClN4O4S and a molecular weight of 458.93 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 16959511 |
| Molecular Formula | C21H19ClN4O4S |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | Cc1sc(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN4O4S/c1-13-19(14-2-4-15(22)5-3-14)23-21(31-13)24-20(27)17-12-16(26(28)29)6-7-18(17)25-8-10-30-11-9-25/h2-7,12H,8-11H2,1H3,(H,23,24,27) |
| InChIKey | RXNLIRZYASSWQP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|