C18H19ClN4O4 — CID 16963255
N-(5-chloro-2-morpholin-4-ylphenyl)-2-(methylamino)-5-nitrobenzamide (PubChem CID 16963255) has the molecular formula C18H19ClN4O4 and a molecular weight of 390.83 g/mol. Its IUPAC name is N-(5-chloro-2-morpholin-4-ylphenyl)-2-(methylamino)-5-nitrobenzamide.
| Compound Name | N-(5-chloro-2-morpholin-4-ylphenyl)-2-(methylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 16963255 |
| Molecular Formula | C18H19ClN4O4 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-(5-chloro-2-morpholin-4-ylphenyl)-2-(methylamino)-5-nitrobenzamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)Nc1cc(Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C18H19ClN4O4/c1-20-15-4-3-13(23(25)26)11-14(15)18(24)21-16-10-12(19)2-5-17(16)22-6-8-27-9-7-22/h2-5,10-11,20H,6-9H2,1H3,(H,21,24) |
| InChIKey | YDQVPDYHHUJUJR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|