C26H31ClN6O5S — CID 43913817
N-[[5-chloro-2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 43913817) has the molecular formula C26H31ClN6O5S and a molecular weight of 575.09 g/mol. Its IUPAC name is N-[[5-chloro-2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[[5-chloro-2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 43913817 |
| Molecular Formula | C26H31ClN6O5S |
| Molecular Weight | 575.09 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | N-[[5-chloro-2-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | CC(C)C(=O)N1CCN(c2ccc(Cl)cc2NC(=S)NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)CC1 |
| InChI | InChI=1S/C26H31ClN6O5S/c1-17(2)25(35)32-9-7-30(8-10-32)23-5-3-18(27)15-21(23)28-26(39)29-24(34)20-16-19(33(36)37)4-6-22(20)31-11-13-38-14-12-31/h3-6,15-17H,7-14H2,1-2H3,(H2,28,29,34,39) |
| InChIKey | SEJQJKSFCMVWNT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 120.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.09 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|