C18H16ClN5O6S — CID 23096101
N-[(2-chloro-4-nitrophenyl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 23096101) has the molecular formula C18H16ClN5O6S and a molecular weight of 465.88 g/mol. Its IUPAC name is N-[(2-chloro-4-nitrophenyl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[(2-chloro-4-nitrophenyl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 23096101 |
| Molecular Formula | C18H16ClN5O6S |
| Molecular Weight | 465.88 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N-[(2-chloro-4-nitrophenyl)carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc([N+](=O)[O-])cc1Cl)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C18H16ClN5O6S/c19-14-10-12(24(28)29)1-3-15(14)20-18(31)21-17(25)13-9-11(23(26)27)2-4-16(13)22-5-7-30-8-6-22/h1-4,9-10H,5-8H2,(H2,20,21,25,31) |
| InChIKey | FKSGZLTXBUHAJZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|