C31H31ClN6O5S — CID 43914551
N-[[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 43914551) has the molecular formula C31H31ClN6O5S and a molecular weight of 635.15 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 43914551 |
| Molecular Formula | C31H31ClN6O5S |
| Molecular Weight | 635.15 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | N-[[3-chloro-4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)/C=C/c3ccccc3)CC2)c(Cl)c1)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C31H31ClN6O5S/c32-26-20-23(7-9-28(26)35-12-14-37(15-13-35)29(39)11-6-22-4-2-1-3-5-22)33-31(44)34-30(40)25-21-24(38(41)42)8-10-27(25)36-16-18-43-19-17-36/h1-11,20-21H,12-19H2,(H2,33,34,40,44)/b11-6+ |
| InChIKey | VQIZVKMZCVRBSB-IZZDOVSWSA-N |
| XLogP | 4.57 |
| TPSA | 120.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.15 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|