C27H24ClIN4O2S — CID 43913704
2-chloro-5-iodo-N-[[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 43913704) has the molecular formula C27H24ClIN4O2S and a molecular weight of 630.94 g/mol. Its IUPAC name is 2-chloro-5-iodo-N-[[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2-chloro-5-iodo-N-[[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 43913704 |
| Molecular Formula | C27H24ClIN4O2S |
| Molecular Weight | 630.94 g/mol |
| Exact Mass | 630.04 |
| IUPAC Name | 2-chloro-5-iodo-N-[[4-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)/C=C/c3ccccc3)CC2)cc1)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C27H24ClIN4O2S/c28-24-12-7-20(29)18-23(24)26(35)31-27(36)30-21-8-10-22(11-9-21)32-14-16-33(17-15-32)25(34)13-6-19-4-2-1-3-5-19/h1-13,18H,14-17H2,(H2,30,31,35,36)/b13-6+ |
| InChIKey | ARLPYTWTTVCKSD-AWNIVKPZSA-N |
| XLogP | 5.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.94 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|