C27H22ClIN4O3S — CID 43913871
N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2-chloro-5-iodobenzamide (PubChem CID 43913871) has the molecular formula C27H22ClIN4O3S and a molecular weight of 644.92 g/mol. Its IUPAC name is N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2-chloro-5-iodobenzamide.
| Compound Name | N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2-chloro-5-iodobenzamide |
|---|---|
| PubChem CID | 43913871 |
| Molecular Formula | C27H22ClIN4O3S |
| Molecular Weight | 644.92 g/mol |
| Exact Mass | 644.01 |
| IUPAC Name | N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-2-chloro-5-iodobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3cc4ccccc4o3)CC2)cc1)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C27H22ClIN4O3S/c28-22-10-5-18(29)16-21(22)25(34)31-27(37)30-19-6-8-20(9-7-19)32-11-13-33(14-12-32)26(35)24-15-17-3-1-2-4-23(17)36-24/h1-10,15-16H,11-14H2,(H2,30,31,34,37) |
| InChIKey | NFQWIGBNXIOGNQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.92 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|