C27H22Cl2N4O3S — CID 17091711
N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3,4-dichlorobenzamide (PubChem CID 17091711) has the molecular formula C27H22Cl2N4O3S and a molecular weight of 553.47 g/mol. Its IUPAC name is N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3,4-dichlorobenzamide.
| Compound Name | N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 17091711 |
| Molecular Formula | C27H22Cl2N4O3S |
| Molecular Weight | 553.47 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | N-[[4-[4-(1-benzofuran-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3,4-dichlorobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3cc4ccccc4o3)CC2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H22Cl2N4O3S/c28-21-10-5-18(15-22(21)29)25(34)31-27(37)30-19-6-8-20(9-7-19)32-11-13-33(14-12-32)26(35)24-16-17-3-1-2-4-23(17)36-24/h1-10,15-16H,11-14H2,(H2,30,31,34,37) |
| InChIKey | CVNJHDFFYDYIDE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|