C23H19Cl3N4O3S — CID 17317994
3,4-dichloro-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 17317994) has the molecular formula C23H19Cl3N4O3S and a molecular weight of 537.86 g/mol. Its IUPAC name is 3,4-dichloro-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17317994 |
| Molecular Formula | C23H19Cl3N4O3S |
| Molecular Weight | 537.86 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | 3,4-dichloro-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H19Cl3N4O3S/c24-16-5-3-14(12-17(16)25)21(31)28-23(34)27-15-4-6-19(18(26)13-15)29-7-9-30(10-8-29)22(32)20-2-1-11-33-20/h1-6,11-13H,7-10H2,(H2,27,28,31,34) |
| InChIKey | MWMHSJQSHRMHIQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.86 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|