C23H18ClF4N3O4 — CID 17118200
N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 17118200) has the molecular formula C23H18ClF4N3O4 and a molecular weight of 511.86 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 17118200 |
| Molecular Formula | C23H18ClF4N3O4 |
| Molecular Weight | 511.86 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)Nc2ccc(N3CCN(C(=O)c4ccco4)CC3)c(Cl)c2)c(F)c1F |
| InChI | InChI=1S/C23H18ClF4N3O4/c1-34-21-19(27)17(25)16(18(26)20(21)28)22(32)29-12-4-5-14(13(24)11-12)30-6-8-31(9-7-30)23(33)15-3-2-10-35-15/h2-5,10-11H,6-9H2,1H3,(H,29,32) |
| InChIKey | IPLZEVPQSFPGSJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.86 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|