C27H29ClN4O4S — CID 17318021
N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide (PubChem CID 17318021) has the molecular formula C27H29ClN4O4S and a molecular weight of 541.07 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide.
| Compound Name | N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17318021 |
| Molecular Formula | C27H29ClN4O4S |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1ccc(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)c4ccco4)CC3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H29ClN4O4S/c1-18(2)17-36-21-8-5-19(6-9-21)25(33)30-27(37)29-20-7-10-23(22(28)16-20)31-11-13-32(14-12-31)26(34)24-4-3-15-35-24/h3-10,15-16,18H,11-14,17H2,1-2H3,(H2,29,30,33,37) |
| InChIKey | CKWNUMCBUWWQRT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|