C24H22Cl3N3O4 — CID 124542404
(2S)-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 124542404) has the molecular formula C24H22Cl3N3O4 and a molecular weight of 522.82 g/mol. Its IUPAC name is (2S)-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | (2S)-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 124542404 |
| Molecular Formula | C24H22Cl3N3O4 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | (2S)-N-[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C24H22Cl3N3O4/c1-15(34-21-7-4-16(25)13-19(21)27)23(31)28-17-5-6-20(18(26)14-17)29-8-10-30(11-9-29)24(32)22-3-2-12-33-22/h2-7,12-15H,8-11H2,1H3,(H,28,31)/t15-/m0/s1 |
| InChIKey | NKEDHBZIUDHGQF-HNNXBMFYSA-N |
| XLogP | 5.61 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|