C21H23Cl3N2O2 — CID 40836957
(2R)-N-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 40836957) has the molecular formula C21H23Cl3N2O2 and a molecular weight of 441.79 g/mol. Its IUPAC name is (2R)-N-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | (2R)-N-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 40836957 |
| Molecular Formula | C21H23Cl3N2O2 |
| Molecular Weight | 441.79 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (2R)-N-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CC1CCN(c2ccc(NC(=O)[C@@H](C)Oc3ccc(Cl)cc3Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C21H23Cl3N2O2/c1-13-7-9-26(10-8-13)19-5-4-16(12-17(19)23)25-21(27)14(2)28-20-6-3-15(22)11-18(20)24/h3-6,11-14H,7-10H2,1-2H3,(H,25,27)/t14-/m1/s1 |
| InChIKey | QUEMSABDRCILCY-CQSZACIVSA-N |
| XLogP | 6.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.79 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|