C19H20Cl2N4O4 — CID 43831138
2-(2,4-dichlorophenoxy)-N-(3-nitro-4-piperazin-1-ylphenyl)propanamide (PubChem CID 43831138) has the molecular formula C19H20Cl2N4O4 and a molecular weight of 439.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(3-nitro-4-piperazin-1-ylphenyl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(3-nitro-4-piperazin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 43831138 |
| Molecular Formula | C19H20Cl2N4O4 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(3-nitro-4-piperazin-1-ylphenyl)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCNCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20Cl2N4O4/c1-12(29-18-5-2-13(20)10-15(18)21)19(26)23-14-3-4-16(17(11-14)25(27)28)24-8-6-22-7-9-24/h2-5,10-12,22H,6-9H2,1H3,(H,23,26) |
| InChIKey | UMTTUDIJYKYZLK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|