C17H16ClN5O5 — CID 28689132
2-chloro-4-nitro-N-(3-nitro-4-piperazin-1-ylphenyl)benzamide (PubChem CID 28689132) has the molecular formula C17H16ClN5O5 and a molecular weight of 405.80 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-(3-nitro-4-piperazin-1-ylphenyl)benzamide.
| Compound Name | 2-chloro-4-nitro-N-(3-nitro-4-piperazin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 28689132 |
| Molecular Formula | C17H16ClN5O5 |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-chloro-4-nitro-N-(3-nitro-4-piperazin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCNCC2)c([N+](=O)[O-])c1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H16ClN5O5/c18-14-10-12(22(25)26)2-3-13(14)17(24)20-11-1-4-15(16(9-11)23(27)28)21-7-5-19-6-8-21/h1-4,9-10,19H,5-8H2,(H,20,24) |
| InChIKey | NORQZLNXHKVRJK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|