C17H16Cl2N4O3 — CID 28689107
3,4-dichloro-N-(3-nitro-4-piperazin-1-ylphenyl)benzamide (PubChem CID 28689107) has the molecular formula C17H16Cl2N4O3 and a molecular weight of 395.25 g/mol. Its IUPAC name is 3,4-dichloro-N-(3-nitro-4-piperazin-1-ylphenyl)benzamide.
| Compound Name | 3,4-dichloro-N-(3-nitro-4-piperazin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 28689107 |
| Molecular Formula | C17H16Cl2N4O3 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 3,4-dichloro-N-(3-nitro-4-piperazin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCNCC2)c([N+](=O)[O-])c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N4O3/c18-13-3-1-11(9-14(13)19)17(24)21-12-2-4-15(16(10-12)23(25)26)22-7-5-20-6-8-22/h1-4,9-10,20H,5-8H2,(H,21,24) |
| InChIKey | DTGXUEAMZXHEIB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|