C24H24N4O4 — CID 28689246
N-(3-nitro-4-piperazin-1-ylphenyl)-4-phenylmethoxybenzamide (PubChem CID 28689246) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-(3-nitro-4-piperazin-1-ylphenyl)-4-phenylmethoxybenzamide.
| Compound Name | N-(3-nitro-4-piperazin-1-ylphenyl)-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 28689246 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-(3-nitro-4-piperazin-1-ylphenyl)-4-phenylmethoxybenzamide |
| SMILES | O=C(Nc1ccc(N2CCNCC2)c([N+](=O)[O-])c1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N4O4/c29-24(19-6-9-21(10-7-19)32-17-18-4-2-1-3-5-18)26-20-8-11-22(23(16-20)28(30)31)27-14-12-25-13-15-27/h1-11,16,25H,12-15,17H2,(H,26,29) |
| InChIKey | ADHRWAMOEXCIPI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|