C27H28N4O5 — CID 46457013
4-(4-acetylpiperazin-1-yl)-3-nitro-N-[[4-(phenoxymethyl)phenyl]methyl]benzamide (PubChem CID 46457013) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-3-nitro-N-[[4-(phenoxymethyl)phenyl]methyl]benzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-3-nitro-N-[[4-(phenoxymethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 46457013 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-3-nitro-N-[[4-(phenoxymethyl)phenyl]methyl]benzamide |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)NCc3ccc(COc4ccccc4)cc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C27H28N4O5/c1-20(32)29-13-15-30(16-14-29)25-12-11-23(17-26(25)31(34)35)27(33)28-18-21-7-9-22(10-8-21)19-36-24-5-3-2-4-6-24/h2-12,17H,13-16,18-19H2,1H3,(H,28,33) |
| InChIKey | MEIBNIQSNULZKN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|