C26H27N3O5 — CID 55381550
N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 55381550) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55381550 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | COc1cc(CNC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H27N3O5/c1-33-25-15-20(9-12-24(25)34-18-19-7-3-2-4-8-19)17-27-26(30)21-10-11-22(23(16-21)29(31)32)28-13-5-6-14-28/h2-4,7-12,15-16H,5-6,13-14,17-18H2,1H3,(H,27,30) |
| InChIKey | LNEHINJJSWFYMF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|