C18H19N5O6 — CID 28689240
2-(2-nitrophenoxy)-N-(3-nitro-4-piperazin-1-ylphenyl)acetamide (PubChem CID 28689240) has the molecular formula C18H19N5O6 and a molecular weight of 401.38 g/mol. Its IUPAC name is 2-(2-nitrophenoxy)-N-(3-nitro-4-piperazin-1-ylphenyl)acetamide.
| Compound Name | 2-(2-nitrophenoxy)-N-(3-nitro-4-piperazin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 28689240 |
| Molecular Formula | C18H19N5O6 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-(2-nitrophenoxy)-N-(3-nitro-4-piperazin-1-ylphenyl)acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])Nc1ccc(N2CCNCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N5O6/c24-18(12-29-17-4-2-1-3-15(17)22(25)26)20-13-5-6-14(16(11-13)23(27)28)21-9-7-19-8-10-21/h1-6,11,19H,7-10,12H2,(H,20,24) |
| InChIKey | CRGQMTIDIJWLMZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|