C24H22N4O4 — CID 4510251
N-(4-benzamidophenyl)-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 4510251) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-(4-benzamidophenyl)-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(4-benzamidophenyl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 4510251 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-(4-benzamidophenyl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22N4O4/c29-23(17-6-2-1-3-7-17)25-19-9-11-20(12-10-19)26-24(30)18-8-13-21(22(16-18)28(31)32)27-14-4-5-15-27/h1-3,6-13,16H,4-5,14-15H2,(H,25,29)(H,26,30) |
| InChIKey | VQBVOYHIMCHUPD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|