C21H20N6O5S — CID 3431064
3-nitro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-4-pyrrolidin-1-ylbenzamide (PubChem CID 3431064) has the molecular formula C21H20N6O5S and a molecular weight of 468.50 g/mol. Its IUPAC name is 3-nitro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-nitro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3431064 |
| Molecular Formula | C21H20N6O5S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 3-nitro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20N6O5S/c28-20(15-4-9-18(19(14-15)27(29)30)26-12-1-2-13-26)24-16-5-7-17(8-6-16)33(31,32)25-21-22-10-3-11-23-21/h3-11,14H,1-2,12-13H2,(H,24,28)(H,22,23,25) |
| InChIKey | GPVLBQNLQISSLR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|