C19H18FN3O5 — CID 122110139
2-[2-fluoro-4-[(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]phenyl]acetic acid (PubChem CID 122110139) has the molecular formula C19H18FN3O5 and a molecular weight of 387.37 g/mol. Its IUPAC name is 2-[2-fluoro-4-[(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-4-[(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 122110139 |
| Molecular Formula | C19H18FN3O5 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-[2-fluoro-4-[(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)cc1F |
| InChI | InChI=1S/C19H18FN3O5/c20-15-11-14(5-3-12(15)10-18(24)25)21-19(26)13-4-6-16(17(9-13)23(27)28)22-7-1-2-8-22/h3-6,9,11H,1-2,7-8,10H2,(H,21,26)(H,24,25) |
| InChIKey | DUCWJSSDFUZQDI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|