C17H16Cl3N3O3 — CID 163326580
4-chloro-N-(3-chloro-4-pyrrolidin-1-ylphenyl)-3-nitrobenzamide;hydrochloride (PubChem CID 163326580) has the molecular formula C17H16Cl3N3O3 and a molecular weight of 416.69 g/mol. Its IUPAC name is 4-chloro-N-(3-chloro-4-pyrrolidin-1-ylphenyl)-3-nitrobenzamide;hydrochloride.
| Compound Name | 4-chloro-N-(3-chloro-4-pyrrolidin-1-ylphenyl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 163326580 |
| Molecular Formula | C17H16Cl3N3O3 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 4-chloro-N-(3-chloro-4-pyrrolidin-1-ylphenyl)-3-nitrobenzamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(N2CCCC2)c(Cl)c1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15Cl2N3O3.ClH/c18-13-5-3-11(9-16(13)22(24)25)17(23)20-12-4-6-15(14(19)10-12)21-7-1-2-8-21;/h3-6,9-10H,1-2,7-8H2,(H,20,23);1H |
| InChIKey | FGTJUQBQBDNTPT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|