C29H29Cl2N5O4 — CID 4211890
N-[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 4211890) has the molecular formula C29H29Cl2N5O4 and a molecular weight of 582.49 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 4211890 |
| Molecular Formula | C29H29Cl2N5O4 |
| Molecular Weight | 582.49 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | N-[3-chloro-4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)c(Cl)c1)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H29Cl2N5O4/c30-22-7-4-20(5-8-22)29(38)35-16-14-34(15-17-35)25-11-9-23(19-24(25)31)32-28(37)21-6-10-26(27(18-21)36(39)40)33-12-2-1-3-13-33/h4-11,18-19H,1-3,12-17H2,(H,32,37) |
| InChIKey | RGBHXQIWVACUBH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|