C25H23ClN4O4 — CID 2084129
N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-4-methyl-3-nitrobenzamide (PubChem CID 2084129) has the molecular formula C25H23ClN4O4 and a molecular weight of 478.94 g/mol. Its IUPAC name is N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 2084129 |
| Molecular Formula | C25H23ClN4O4 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCN(C(=O)c4ccccc4)CC3)c(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H23ClN4O4/c1-17-7-8-19(15-23(17)30(33)34)24(31)27-20-9-10-22(21(26)16-20)28-11-13-29(14-12-28)25(32)18-5-3-2-4-6-18/h2-10,15-16H,11-14H2,1H3,(H,27,31) |
| InChIKey | YHPVGYUVSZJFIS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|