C21H23ClN4O4 — CID 55616659
N-[4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]phenyl]-2-methylpropanamide (PubChem CID 55616659) has the molecular formula C21H23ClN4O4 and a molecular weight of 430.89 g/mol. Its IUPAC name is N-[4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 55616659 |
| Molecular Formula | C21H23ClN4O4 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C21H23ClN4O4/c1-14(2)20(27)23-17-6-3-15(4-7-17)21(28)25-11-9-24(10-12-25)18-8-5-16(22)13-19(18)26(29)30/h3-8,13-14H,9-12H2,1-2H3,(H,23,27) |
| InChIKey | UPUKEIJNXGKSQI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|