C19H19FN4O4 — CID 51192088
4-(4-acetylpiperazin-1-yl)-N-(4-fluorophenyl)-3-nitrobenzamide (PubChem CID 51192088) has the molecular formula C19H19FN4O4 and a molecular weight of 386.38 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-(4-fluorophenyl)-3-nitrobenzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-(4-fluorophenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 51192088 |
| Molecular Formula | C19H19FN4O4 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-(4-fluorophenyl)-3-nitrobenzamide |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)Nc3ccc(F)cc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H19FN4O4/c1-13(25)22-8-10-23(11-9-22)17-7-2-14(12-18(17)24(27)28)19(26)21-16-5-3-15(20)4-6-16/h2-7,12H,8-11H2,1H3,(H,21,26) |
| InChIKey | WWIORWORKRWQKQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|