C23H25N5O5 — CID 55413491
4-(4-acetylpiperazin-1-yl)-3-nitro-N-[2-(prop-2-enylcarbamoyl)phenyl]benzamide (PubChem CID 55413491) has the molecular formula C23H25N5O5 and a molecular weight of 451.48 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-3-nitro-N-[2-(prop-2-enylcarbamoyl)phenyl]benzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-3-nitro-N-[2-(prop-2-enylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55413491 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-3-nitro-N-[2-(prop-2-enylcarbamoyl)phenyl]benzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)c1ccc(N2CCN(C(C)=O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25N5O5/c1-3-10-24-23(31)18-6-4-5-7-19(18)25-22(30)17-8-9-20(21(15-17)28(32)33)27-13-11-26(12-14-27)16(2)29/h3-9,15H,1,10-14H2,2H3,(H,24,31)(H,25,30) |
| InChIKey | SRWQCVGQOBICNO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|