C24H22FN5O5 — CID 55713882
4-(4-acetylpiperazin-1-yl)-N-[6-(4-fluorophenoxy)-3-pyridinyl]-3-nitrobenzamide (PubChem CID 55713882) has the molecular formula C24H22FN5O5 and a molecular weight of 479.47 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-[6-(4-fluorophenoxy)-3-pyridinyl]-3-nitrobenzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-[6-(4-fluorophenoxy)-3-pyridinyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55713882 |
| Molecular Formula | C24H22FN5O5 |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-[6-(4-fluorophenoxy)-3-pyridinyl]-3-nitrobenzamide |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)Nc3ccc(Oc4ccc(F)cc4)nc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H22FN5O5/c1-16(31)28-10-12-29(13-11-28)21-8-2-17(14-22(21)30(33)34)24(32)27-19-5-9-23(26-15-19)35-20-6-3-18(25)4-7-20/h2-9,14-15H,10-13H2,1H3,(H,27,32) |
| InChIKey | IVBRMWIFBPKEQA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|