C18H16ClN5O3 — CID 27808577
3H-benzimidazol-5-yl-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 27808577) has the molecular formula C18H16ClN5O3 and a molecular weight of 385.81 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | 3H-benzimidazol-5-yl-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27808577 |
| Molecular Formula | C18H16ClN5O3 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 3H-benzimidazol-5-yl-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H16ClN5O3/c19-13-2-4-16(17(10-13)24(26)27)22-5-7-23(8-6-22)18(25)12-1-3-14-15(9-12)21-11-20-14/h1-4,9-11H,5-8H2,(H,20,21) |
| InChIKey | YKCIXXPJDOFOGV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|