C15H18N4O2 — CID 60712264
1-[4-(3H-benzimidazole-5-carbonyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 60712264) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-[4-(3H-benzimidazole-5-carbonyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(3H-benzimidazole-5-carbonyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 60712264 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-[4-(3H-benzimidazole-5-carbonyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(C(=O)c2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C15H18N4O2/c1-11(20)18-5-2-6-19(8-7-18)15(21)12-3-4-13-14(9-12)17-10-16-13/h3-4,9-10H,2,5-8H2,1H3,(H,16,17) |
| InChIKey | MWIFBAORSBNPMA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |