C12H13N3O3S — CID 43582193
3H-benzimidazol-5-yl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 43582193) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | 3H-benzimidazol-5-yl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 43582193 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3H-benzimidazol-5-yl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H13N3O3S/c16-12(15-3-5-19(17,18)6-4-15)9-1-2-10-11(7-9)14-8-13-10/h1-2,7-8H,3-6H2,(H,13,14) |
| InChIKey | JHHLZPHGUWMLCF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |