C17H17N7O2 — CID 126783994
[4-(3-aminopyrazine-2-carbonyl)piperazin-1-yl]-(3H-benzimidazol-5-yl)methanone (PubChem CID 126783994) has the molecular formula C17H17N7O2 and a molecular weight of 351.37 g/mol. Its IUPAC name is [4-(3-aminopyrazine-2-carbonyl)piperazin-1-yl]-(3H-benzimidazol-5-yl)methanone.
| Compound Name | [4-(3-aminopyrazine-2-carbonyl)piperazin-1-yl]-(3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 126783994 |
| Molecular Formula | C17H17N7O2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | [4-(3-aminopyrazine-2-carbonyl)piperazin-1-yl]-(3H-benzimidazol-5-yl)methanone |
| SMILES | Nc1nccnc1C(=O)N1CCN(C(=O)c2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C17H17N7O2/c18-15-14(19-3-4-20-15)17(26)24-7-5-23(6-8-24)16(25)11-1-2-12-13(9-11)22-10-21-12/h1-4,9-10H,5-8H2,(H2,18,20)(H,21,22) |
| InChIKey | JXMWEKXODRIBBK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |