C13H16N4O — CID 18847527
3H-benzimidazol-5-yl-(4-methylpiperazin-1-yl)methanone (PubChem CID 18847527) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-(4-methylpiperazin-1-yl)methanone.
| Compound Name | 3H-benzimidazol-5-yl-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 18847527 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3H-benzimidazol-5-yl-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C13H16N4O/c1-16-4-6-17(7-5-16)13(18)10-2-3-11-12(8-10)15-9-14-11/h2-3,8-9H,4-7H2,1H3,(H,14,15) |
| InChIKey | BKQAPXMMLSWOEV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |