C17H17N5O2 — CID 110814747
3H-benzimidazol-5-yl-[4-(1H-pyrrole-3-carbonyl)piperazin-1-yl]methanone (PubChem CID 110814747) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-[4-(1H-pyrrole-3-carbonyl)piperazin-1-yl]methanone.
| Compound Name | 3H-benzimidazol-5-yl-[4-(1H-pyrrole-3-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110814747 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3H-benzimidazol-5-yl-[4-(1H-pyrrole-3-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc[nH]c1)N1CCN(C(=O)c2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C17H17N5O2/c23-16(12-1-2-14-15(9-12)20-11-19-14)21-5-7-22(8-6-21)17(24)13-3-4-18-10-13/h1-4,9-11,18H,5-8H2,(H,19,20) |
| InChIKey | IGWREGZMIDHSNC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |