C16H18N4O3 — CID 108569341
prop-2-enyl 4-(3H-benzimidazole-5-carbonyl)piperazine-1-carboxylate (PubChem CID 108569341) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is prop-2-enyl 4-(3H-benzimidazole-5-carbonyl)piperazine-1-carboxylate.
| Compound Name | prop-2-enyl 4-(3H-benzimidazole-5-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108569341 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | prop-2-enyl 4-(3H-benzimidazole-5-carbonyl)piperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCN(C(=O)c2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C16H18N4O3/c1-2-9-23-16(22)20-7-5-19(6-8-20)15(21)12-3-4-13-14(10-12)18-11-17-13/h2-4,10-11H,1,5-9H2,(H,17,18) |
| InChIKey | BXVCFHZTHDIGOE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|