C19H17ClN4O5 — CID 30495547
7-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 30495547) has the molecular formula C19H17ClN4O5 and a molecular weight of 416.82 g/mol. Its IUPAC name is 7-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 30495547 |
| Molecular Formula | C19H17ClN4O5 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 7-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(C(=O)N3CCN(c4ccc(Cl)cc4[N+](=O)[O-])CC3)ccc2N1 |
| InChI | InChI=1S/C19H17ClN4O5/c20-13-2-4-15(16(10-13)24(27)28)22-5-7-23(8-6-22)19(26)12-1-3-14-17(9-12)29-11-18(25)21-14/h1-4,9-10H,5-8,11H2,(H,21,25) |
| InChIKey | UFUMPZDGEKRXDC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|