C20H18ClFN4O4 — CID 22829875
4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 22829875) has the molecular formula C20H18ClFN4O4 and a molecular weight of 432.84 g/mol. Its IUPAC name is 4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 22829875 |
| Molecular Formula | C20H18ClFN4O4 |
| Molecular Weight | 432.84 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CC(C(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)c2ccc(F)cc2N1 |
| InChI | InChI=1S/C20H18ClFN4O4/c21-12-1-4-17(18(9-12)26(29)30)24-5-7-25(8-6-24)20(28)15-11-19(27)23-16-10-13(22)2-3-14(15)16/h1-4,9-10,15H,5-8,11H2,(H,23,27) |
| InChIKey | OIUITJRLDZSASP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.84 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|