C20H21ClFN5O4 — CID 25413876
1-[2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 25413876) has the molecular formula C20H21ClFN5O4 and a molecular weight of 449.87 g/mol. Its IUPAC name is 1-[2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 25413876 |
| Molecular Formula | C20H21ClFN5O4 |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 1-[2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(NCC(=O)N1CCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21ClFN5O4/c21-15-3-6-17(18(11-15)27(30)31)25-7-9-26(10-8-25)19(28)13-24-20(29)23-12-14-1-4-16(22)5-2-14/h1-6,11H,7-10,12-13H2,(H2,23,24,29) |
| InChIKey | WKGZOCBUJNDGOH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|