C20H22ClN3O3S — CID 26660176
1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone (PubChem CID 26660176) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone.
| Compound Name | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone |
|---|---|
| PubChem CID | 26660176 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone |
| SMILES | Cc1ccc(CSCC(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C20H22ClN3O3S/c1-15-2-4-16(5-3-15)13-28-14-20(25)23-10-8-22(9-11-23)18-7-6-17(21)12-19(18)24(26)27/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | IAVHZIJGARCZNY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|