C22H24ClN3O4 — CID 27808939
1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-4-(3,4-dimethylphenyl)butane-1,4-dione (PubChem CID 27808939) has the molecular formula C22H24ClN3O4 and a molecular weight of 429.90 g/mol. Its IUPAC name is 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-4-(3,4-dimethylphenyl)butane-1,4-dione.
| Compound Name | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-4-(3,4-dimethylphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 27808939 |
| Molecular Formula | C22H24ClN3O4 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-4-(3,4-dimethylphenyl)butane-1,4-dione |
| SMILES | Cc1ccc(C(=O)CCC(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)cc1C |
| InChI | InChI=1S/C22H24ClN3O4/c1-15-3-4-17(13-16(15)2)21(27)7-8-22(28)25-11-9-24(10-12-25)19-6-5-18(23)14-20(19)26(29)30/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | PYTVCIDUWJXGLL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|