C21H23ClN4O4 — CID 2971790
N-[5-chloro-2-(4-propanoylpiperazin-1-yl)phenyl]-3-methyl-4-nitrobenzamide (PubChem CID 2971790) has the molecular formula C21H23ClN4O4 and a molecular weight of 430.89 g/mol. Its IUPAC name is N-[5-chloro-2-(4-propanoylpiperazin-1-yl)phenyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[5-chloro-2-(4-propanoylpiperazin-1-yl)phenyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 2971790 |
| Molecular Formula | C21H23ClN4O4 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[5-chloro-2-(4-propanoylpiperazin-1-yl)phenyl]-3-methyl-4-nitrobenzamide |
| SMILES | CCC(=O)N1CCN(c2ccc(Cl)cc2NC(=O)c2ccc([N+](=O)[O-])c(C)c2)CC1 |
| InChI | InChI=1S/C21H23ClN4O4/c1-3-20(27)25-10-8-24(9-11-25)19-7-5-16(22)13-17(19)23-21(28)15-4-6-18(26(29)30)14(2)12-15/h4-7,12-13H,3,8-11H2,1-2H3,(H,23,28) |
| InChIKey | QCMWUBQFKCTVBV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|