C13H14FNO2 — CID 82116552
1-(aziridin-1-yl)-4-(4-fluoro-3-methylphenyl)butane-1,4-dione (PubChem CID 82116552) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 1-(aziridin-1-yl)-4-(4-fluoro-3-methylphenyl)butane-1,4-dione.
| Compound Name | 1-(aziridin-1-yl)-4-(4-fluoro-3-methylphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 82116552 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-(aziridin-1-yl)-4-(4-fluoro-3-methylphenyl)butane-1,4-dione |
| SMILES | Cc1cc(C(=O)CCC(=O)N2CC2)ccc1F |
| InChI | InChI=1S/C13H14FNO2/c1-9-8-10(2-3-11(9)14)12(16)4-5-13(17)15-6-7-15/h2-3,8H,4-7H2,1H3 |
| InChIKey | KBFUSGMPPMEDNZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|