C17H23NO2 — CID 94282653
1-(3,4-dimethylphenyl)-4-piperidin-1-ylbutane-1,4-dione (PubChem CID 94282653) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4-piperidin-1-ylbutane-1,4-dione.
| Compound Name | 1-(3,4-dimethylphenyl)-4-piperidin-1-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 94282653 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4-piperidin-1-ylbutane-1,4-dione |
| SMILES | Cc1ccc(C(=O)CCC(=O)N2CCCCC2)cc1C |
| InChI | InChI=1S/C17H23NO2/c1-13-6-7-15(12-14(13)2)16(19)8-9-17(20)18-10-4-3-5-11-18/h6-7,12H,3-5,8-11H2,1-2H3 |
| InChIKey | TZHFUNPEUQIURQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |