C22H21ClN4O5 — CID 27808712
2-[3-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-5-methylisoindole-1,3-dione (PubChem CID 27808712) has the molecular formula C22H21ClN4O5 and a molecular weight of 456.89 g/mol. Its IUPAC name is 2-[3-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-5-methylisoindole-1,3-dione.
| Compound Name | 2-[3-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-5-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 27808712 |
| Molecular Formula | C22H21ClN4O5 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-[3-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-5-methylisoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)N1CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC1)C2=O |
| InChI | InChI=1S/C22H21ClN4O5/c1-14-2-4-16-17(12-14)22(30)26(21(16)29)7-6-20(28)25-10-8-24(9-11-25)18-5-3-15(23)13-19(18)27(31)32/h2-5,12-13H,6-11H2,1H3 |
| InChIKey | FJYXMONGONCEQW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|