C14H14ClN5O3S2 — CID 40749869
1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)ethanone (PubChem CID 40749869) has the molecular formula C14H14ClN5O3S2 and a molecular weight of 399.89 g/mol. Its IUPAC name is 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)ethanone.
| Compound Name | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 40749869 |
| Molecular Formula | C14H14ClN5O3S2 |
| Molecular Weight | 399.89 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1nncs1)N1CCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H14ClN5O3S2/c15-10-1-2-11(12(7-10)20(22)23)18-3-5-19(6-4-18)13(21)8-24-14-17-16-9-25-14/h1-2,7,9H,3-6,8H2 |
| InChIKey | SDWDQDDCBIHZMW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.89 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|