C21H29ClN4O3 — CID 11926117
2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 11926117) has the molecular formula C21H29ClN4O3 and a molecular weight of 420.94 g/mol. Its IUPAC name is 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 11926117 |
| Molecular Formula | C21H29ClN4O3 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCC[C@H]2CCCC[C@@H]21)N1CCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H29ClN4O3/c22-17-7-8-19(20(14-17)26(28)29)23-10-12-24(13-11-23)21(27)15-25-9-3-5-16-4-1-2-6-18(16)25/h7-8,14,16,18H,1-6,9-13,15H2/t16-,18+/m1/s1 |
| InChIKey | XNFJEUCOKIETOW-AEFFLSMTSA-N |
| XLogP | 3.55 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|