C18H25ClN4O3 — CID 95157459
2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-1-[(2R)-2-methylpiperidin-1-yl]ethanone (PubChem CID 95157459) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is 2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-1-[(2R)-2-methylpiperidin-1-yl]ethanone.
| Compound Name | 2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-1-[(2R)-2-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95157459 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-1-[(2R)-2-methylpiperidin-1-yl]ethanone |
| SMILES | C[C@@H]1CCCCN1C(=O)CN1CCN(c2ccc(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H25ClN4O3/c1-14-4-2-3-7-22(14)18(24)13-20-8-10-21(11-9-20)16-6-5-15(19)12-17(16)23(25)26/h5-6,12,14H,2-4,7-11,13H2,1H3/t14-/m1/s1 |
| InChIKey | CXRAOWMGVFQDFX-CQSZACIVSA-N |
| XLogP | 2.77 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|